
39885-50-2
| Name | 4-Amino-3-chlorobenzotrifluoride |
| CAS | 39885-50-2 |
| EINECS(EC#) | 254-674-8 |
| Molecular Formula | C7H5ClF3N |
| MDL Number | MFCD00042563 |
| Molecular Weight | 195.57 |
| MOL File | 39885-50-2.mol |
Chemical Properties
| Appearance | clear light yellow to yellow liquid after melting |
| Boiling point | 214-218 °C(lit.) |
| density | 1.4160 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 218 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 0.82±0.10(Predicted) |
| color | Colorless to Light yellow |
| BRN | 4179703 |
| InChI | InChI=1S/C7H5ClF3N/c8-5-3-4(7(9,10)11)1-2-6(5)12/h1-3H,12H2 |
| InChIKey | MBBUTABXEITVNY-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C(F)(F)F)C=C1Cl |
| CAS DataBase Reference | 39885-50-2(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |