
461-82-5
| Name | 4-(Trifluoromethoxy)aniline |
| CAS | 461-82-5 |
| EINECS(EC#) | 207-317-5 |
| Molecular Formula | C7H6F3NO |
| MDL Number | MFCD00041314 |
| Molecular Weight | 177.12 |
| MOL File | 461-82-5.mol |
Chemical Properties
| Appearance | CLEAR YELLOW LIQUID |
| Boiling point | 73-75 °C10 mm Hg(lit.) |
| density | 1.32 g/mL at 20 °C(lit.) |
| refractive index | n |
| Fp | 177 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 3.75±0.10(Predicted) |
| color | Clear colorless to yellow |
| Specific Gravity | 1.310 |
| BRN | 2090209 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H6F3NO/c8-7(9,10)12-6-3-1-5(11)2-4-6/h1-4H,11H2 |
| InChIKey | XUJFOSLZQITUOI-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference | 461-82-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H310-H315-H318-H373 |
| Precautionary statements | P260-P280-P280-P301+P330+P331+P310-P302+P352+P310-P305+P351+P338+P310 |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2941 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Toxic |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| HazardClass | IRRITANT, TOXIC |
| PackingGroup | III |
| HS Code | 29222900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT RE 2 |


