| Melting point |
15°C |
| Boiling point |
87 °C |
| Density |
1,447 g/cm3 |
| refractive index |
1.467 |
| Flash point |
87-89°C/15mm |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Soluble), Methanol (Sparingly) |
| form |
clear liquid |
| color |
Light orange to Yellow to Green |
| Water Solubility |
Not miscible or difficult to mix in water. |
| BRN |
1966388 |
| InChI |
InChI=1S/C7H4F3NO3/c8-7(9,10)14-6-3-1-5(2-4-6)11(12)13/h1-4H |
| InChIKey |
UBEIKVUMDBCCRW-UHFFFAOYSA-N |
| SMILES |
C1([N+]([O-])=O)=CC=C(OC(F)(F)F)C=C1 |
| CAS DataBase Reference |
713-65-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Alpha,alpha,alpha-trifluoro-4'-nitroanisole(713-65-5) |
