1535-73-5
| Name | 3-(Trifluoromethoxy)aniline |
| CAS | 1535-73-5 |
| EINECS(EC#) | 216-256-3 |
| Molecular Formula | C7H6F3NO |
| MDL Number | MFCD00041511 |
| Molecular Weight | 177.12 |
| MOL File | 1535-73-5.mol |
Chemical Properties
| Appearance | CLEAR YELLOW LIQUID |
| Boiling point | 72-73 °C8 mm Hg(lit.) |
| density | 1.325 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 185 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| pka | 3.36±0.10(Predicted) |
| color | Clear yellow to orange |
| Specific Gravity | 1.325 |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 776921 |
| InChI | InChI=1S/C7H6F3NO/c8-7(9,10)12-6-3-1-2-5(11)4-6/h1-4H,11H2 |
| InChIKey | SADHVOSOZBAAGL-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 1535-73-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| HazardClass | IRRITANT, TOXIC |
| HS Code | 29222900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |