
2375-03-3
| Name | 6alpha-Methylprednisolone sodium succinate |
| CAS | 2375-03-3 |
| EINECS(EC#) | 219-156-8 |
| Molecular Formula | C48H64Na2O14 |
| MDL Number | MFCD00152612 |
| Molecular Weight | 910.99 |
| MOL File | 2375-03-3.mol |
Chemical Properties
| Melting point | >186°C (dec.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | lyophilized powder |
| color | White to Off-White |
| biological source | synthetic |
| Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow |
| InChIKey | FQISKWAFAHGMGT-JXAFMBTDNA-M |
| SMILES | [C@]12(C[C@@H](C3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@H](C[C@]1(C)[C@@](CC[C@@]21[H])(O)C(=O)COC(=O)CCC([O-])=O)O)C)[H].[Na+] |&1:0,2,9,11,13,15,17,20,r| |
| CAS DataBase Reference | 2375-03-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H351-H360 |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | TU4154060 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 2 Repr. 1B |
| Toxicity |
