23190-16-1
| Name | (1R,2S)-2-Amino-1,2-diphenylethanol |
| CAS | 23190-16-1 |
| Molecular Formula | C14H15NO |
| MDL Number | MFCD00074960 |
| Molecular Weight | 213.27 |
| MOL File | 23190-16-1.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 142-144 °C(lit.) |
| alpha | -7 º (c=0.6, EtOH) |
| Boiling point | 374.3±37.0 °C(Predicted) |
| density | 1.148±0.06 g/cm3(Predicted) |
| refractive index | -7 ° (C=0.6, EtOH) |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethanol, Methanol |
| form | Powder |
| pka | 11.70±0.45(Predicted) |
| color | white to light-yellow |
| Optical Rotation | [α]25/D 7.0°, c = 0.6 in ethanol |
| Detection Methods | NT |
| BRN | 2806218 |
| InChI | InChI=1/C14H15NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14,16H,15H2/t13-,14+/s3 |
| InChIKey | GEJJWYZZKKKSEV-JJANDPSINA-N |
| SMILES | [C@@H](C1C=CC=CC=1)(N)[C@@H](C1C=CC=CC=1)O |&1:0,8,r| |
| CAS DataBase Reference | 23190-16-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |