2105-61-5
| Name | 1,2,4-Trifluoro-5-nitrobenzene |
| CAS | 2105-61-5 |
| EINECS(EC#) | 218-281-5 |
| Molecular Formula | C6H2F3NO2 |
| MDL Number | MFCD00007051 |
| Molecular Weight | 177.08 |
| MOL File | 2105-61-5.mol |
Chemical Properties
| Appearance | clear brown liquid |
| Melting point | -11 °C (lit.) |
| Boiling point | 194-195 °C (lit.) |
| density | 1.544 g/mL at 25 °C(lit.) |
| refractive index | 1.493-1.495 |
| Fp | 89 °C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Light yellow to Brown to Dark green |
| Specific Gravity | 1.56 |
| BRN | 2504370 |
| InChI | InChI=1S/C6H2F3NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
| InChIKey | ROJNMGYMBLNTPK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC([N+]([O-])=O)=C(F)C=C1F |
| CAS DataBase Reference | 2105-61-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2,4-trifluoro-5-nitro-(2105-61-5) |
Safety Data
| Hazard Codes | Xn,Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |