
315-14-0
| Name | 1,3,5-Trifluoro-2-nitrobenzene |
| CAS | 315-14-0 |
| EINECS(EC#) | 206-248-8 |
| Molecular Formula | C6H2F3NO2 |
| MDL Number | MFCD00014687 |
| Molecular Weight | 177.08 |
| MOL File | 315-14-0.mol |
Chemical Properties
| Appearance | clear yellow liquid |
| Melting point | 3.5 °C(lit.) |
| Boiling point | 182-185 °C(lit.) |
| density | 1.514 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 172 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Specific Gravity | 1.514 |
| BRN | 2106869 |
| InChI | InChI=1S/C6H2F3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
| InChIKey | PWRFDGYYJWQIAB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(F)=CC(F)=C1[N+]([O-])=O |
| CAS DataBase Reference | 315-14-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |