
771-69-7
| Name | 1,2,3-Trifluoro-4-nitrobenzene |
| CAS | 771-69-7 |
| EINECS(EC#) | 212-238-4 |
| Molecular Formula | C6H2F3NO2 |
| MDL Number | MFCD00041546 |
| Molecular Weight | 177.08 |
| MOL File | 771-69-7.mol |
Chemical Properties
| Appearance | clear yellow liquid after melting |
| Boiling point | 92 °C/20 mmHg (lit.) |
| density | 1.541 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 200 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Specific Gravity | 1.541 |
| BRN | 2449746 |
| InChI | InChI=1S/C6H2F3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| InChIKey | ARCACZWMYGILNI-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C([N+]([O-])=O)C(F)=C1F |
| CAS DataBase Reference | 771-69-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29042090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
