
19064-24-5
| Name | 2,6-Difluoronitrobenzene |
| CAS | 19064-24-5 |
| EINECS(EC#) | 242-793-8 |
| Molecular Formula | C6H3F2NO2 |
| MDL Number | MFCD00192035 |
| Molecular Weight | 159.09 |
| MOL File | 19064-24-5.mol |
Chemical Properties
| Melting point | 0C |
| Boiling point | 91-92 °C/11 mmHg (lit.) |
| density | 1.503 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 190 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to lump to clear liquid |
| color | Light yellow to Yellow to Green |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H3F2NO2/c7-4-2-1-3-5(8)6(4)9(10)11/h1-3H |
| InChIKey | SSNCMIDZGFCTST-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1[N+]([O-])=O |
| CAS DataBase Reference | 19064-24-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
