350-30-1
| Name | 3-Chloro-4-fluoronitrobenzene |
| CAS | 350-30-1 |
| EINECS(EC#) | 206-499-3 |
| Molecular Formula | C6H3ClFNO2 |
| MDL Number | MFCD00007206 |
| Molecular Weight | 175.54 |
| MOL File | 350-30-1.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 40-42 °C(lit.) |
| Boiling point | 227-232°C |
| density | 1.61 |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Green |
| BRN | 1944997 |
| InChI | InChI=1S/C6H3ClFNO2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H |
| InChIKey | DPHCXXYPSYMICK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C([N+]([O-])=O)C=C1Cl |
| CAS DataBase Reference | 350-30-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Chloro-4-fluoronitrobenzene(350-30-1) |
| EPA Substance Registry System | 350-30-1(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | CZ0720000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
;