20005-42-9
| Name | 5-(4-Bromophenyl)furfural |
| CAS | 20005-42-9 |
| Molecular Formula | C11H7BrO2 |
| MDL Number | MFCD00239387 |
| Molecular Weight | 251.08 |
| MOL File | 20005-42-9.mol |
Chemical Properties
| Appearance | brown powder |
| Melting point | 152-155 °C(lit.) |
| Boiling point | 371.9±32.0 °C(Predicted) |
| density | 1.518±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | Orange to Amber to Dark red |
| InChI | 1S/C11H7BrO2/c12-9-3-1-8(2-4-9)11-6-5-10(7-13)14-11/h1-7H |
| InChIKey | QRTAOOSYSVHQGT-UHFFFAOYSA-N |
| SMILES | Brc1ccc(cc1)-c2ccc(C=O)o2 |
| CAS DataBase Reference | 20005-42-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
