1878-66-6
| Name | 4-Chlorophenylacetic acid |
| CAS | 1878-66-6 |
| EINECS(EC#) | 217-521-6 |
| Molecular Formula | C8H7ClO2 |
| MDL Number | MFCD00004344 |
| Molecular Weight | 170.59 |
| MOL File | 1878-66-6.mol |
Chemical Properties
| Appearance | white to cream colored powder |
| Melting point | 102-105 °C(lit.) |
| Boiling point | 241.44°C (rough estimate) |
| density | 1.2315 (rough estimate) |
| refractive index | 1.5660 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble100mg/mL, clear, faintly yellow |
| form | Powder |
| pka | 4.19(at 25℃) |
| color | White to cream |
| PH | 2.5-3 (100g/l, H2O, 20℃)suspension |
| Detection Methods | T,NMR |
| BRN | 1072816 |
| InChI | InChI=1S/C8H7ClO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | CDPKJZJVTHSESZ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 1878-66-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, p-chlorophenyl-(1878-66-6) |
| EPA Substance Registry System | 1878-66-6(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P280-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | AG0590000 |
| F | 13 |
| TSCA | Yes |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity |