4-Chlorophenethylalcohol
- Product Name4-Chlorophenethylalcohol
- CAS1875-88-3
- MFC8H9ClO
- MW156.61
- EINECS217-506-4
- MOL File1875-88-3.mol
Chemical Properties
| Boiling point | 110 °C/0.5 mmHg (lit.) |
| Density | 1.157 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 14.79±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C8H9ClO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6H2 |
| InChIKey | HZFRKZWBVUJYDA-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 1875-88-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chlorophenyl methyl carbinol(1875-88-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29062990 |
