
15625-89-5
| Name | Trimethylolpropane triacrylate |
| CAS | 15625-89-5 |
| EINECS(EC#) | 239-701-3 |
| Molecular Formula | C15H20O6 |
| MDL Number | MFCD00008628 |
| Molecular Weight | 296.32 |
| MOL File | 15625-89-5.mol |
Chemical Properties
| Melting point | -66°C |
| Boiling point | >200°C |
| density | 1.1 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | <0.01 mm Hg ( 20 °C) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Refrigerator |
| form | Liquid |
| pka | 0[at 20 ℃] |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.1 |
| Water Solubility | Miscible with water. |
| FreezingPoint | -66 |
| Henry's Law Constant | 1.6×104 mol/(m3Pa) at 25℃, HSDB (2015) |
| Cosmetics Ingredients Functions | FILM FORMING HAIR CONDITIONING HAIR FIXING |
| InChI | 1S/C15H20O6/c1-5-12(16)19-9-15(8-4,10-20-13(17)6-2)11-21-14(18)7-3/h5-7H,1-3,8-11H2,4H3 |
| InChIKey | DAKWPKUUDNSNPN-UHFFFAOYSA-N |
| SMILES | CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| RTECS | AT4810000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 15625-89-5(Hazardous Substances Data) |
| Toxicity |

