30499-70-8
| Name | Trimethylolpropane triglycidyl ether |
| CAS | 30499-70-8 |
| EINECS(EC#) | 222-384-0 |
| Molecular Formula | C15H26O6 |
| MDL Number | MFCD00274208 |
| Molecular Weight | 302.36 |
| MOL File | 30499-70-8.mol |
Chemical Properties
| density | 1.157 g/mL at 25 °C (lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Store at room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | viscous liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C6H14O3.C3H5ClO/c1-2-6(3-7,4-8)5-9;4-1-3-2-5-3/h7-9H,2-5H2,1H3;3H,1-2H2 |
| InChIKey | HNCWRXZORGVRPD-UHFFFAOYSA-N |
| SMILES | C(CO)(CO)(CO)CC.C(C1OC1)Cl |
| EPA Substance Registry System | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)-, polymer with (chloromethyl)oxirane (30499-70-8) |
Safety Data
| Symbol(GHS) |     GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H314-H317-H341-H351-H361-H411 |
| Precautionary statements | P202-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Chronic 2 Carc. 2 Eye Dam. 1 Muta. 2 Repr. 2 Skin Corr. 1B Skin Sens. 1 |