
1492-18-8
| Name | Calcium folinate |
| CAS | 1492-18-8 |
| EINECS(EC#) | 216-082-8 |
| Molecular Formula | C20H21CaN7O7 |
| MDL Number | MFCD00006704 |
| Molecular Weight | 511.5 |
| MOL File | 1492-18-8.mol |
Chemical Properties
| Melting point | >300°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Sparingly soluble in water, practically insoluble in acetone and in ethanol (96 per cent). |
| form | powder |
| color | Pale Yellow to Light Yellow |
| biological source | synthetic (organic) |
| BRN | 5723924 |
| BCS Class | 1 |
| Stability: | Hygroscopic |
| Major Application | cell analysis |
| InChIKey | SFFPBUMPHJUNTG-OKWBDBCSNA-N |
| SMILES | C(N1C(CNC2NC(N)=NC(=O)C1=2)CNC1C=CC(C(=O)N[C@H](C(=O)O)CCC(=O)O)=CC=1)=O.[Ca] |&1:22,r| |
| LogP | -3.187 (est) |
| CAS DataBase Reference | 1492-18-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | MA0600500 |
| F | 3-8-10-23 |
| HS Code | 29362900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |

