1121-78-4
| Name | 3-Hydroxy-6-methylpyridine |
| CAS | 1121-78-4 |
| EINECS(EC#) | 214-337-8 |
| Molecular Formula | C6H7NO |
| MDL Number | MFCD00006339 |
| Molecular Weight | 109.13 |
| MOL File | 1121-78-4.mol |
Chemical Properties
| Appearance | beige to light tan crystalline powder |
| Melting point | 168-170 °C(lit.) |
| Boiling point | 204.59°C (rough estimate) |
| density | 1.1143 (rough estimate) |
| refractive index | 1.5040 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | dichloromethane: soluble |
| form | Crystalline Powder |
| pka | 9.49±0.10(Predicted) |
| color | Beige to light tan |
| BRN | 107077 |
| InChI | InChI=1S/C6H7NO/c1-5-2-3-6(8)4-7-5/h2-4,8H,1H3 |
| InChIKey | DHLUJPLHLZJUBW-UHFFFAOYSA-N |
| SMILES | C1=NC(C)=CC=C1O |
| LogP | 0.418 (est) |
| CAS DataBase Reference | 1121-78-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Pyridinol, 6-methyl-(1121-78-4) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | UU7714900 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Toxicity |