| Melting point |
115-116 °C (lit.) |
| alpha |
D20 -81.4° (c = 1.04 in chloroform); D22 -71.4° (c = 0.220 in CH2Cl2) |
| Boiling point |
394.1±42.0 °C(Predicted) |
| Density |
1.13±0.1 g/cm3(Predicted) |
| storage temp. |
-20°C |
| solubility |
Soluble in DMSO (up to 100 mg/ml) or in Ethanol (up to 20 mg/ml) |
| form |
White solid |
| color |
White |
| Merck |
14,7048 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING |
| InChI |
InChI=1S/C15H20O3/c1-9-5-4-8-15(3)13(18-15)12-11(7-6-9)10(2)14(16)17-12/h5,11-13H,2,4,6-8H2,1,3H3/b9-5+/t11-,12-,13+,15+/m0/s1 |
| InChIKey |
KTEXNACQROZXEV-PVLRGYAZSA-N |
| SMILES |
O1C(=O)C(=C)[C@]2([H])CCC(C)=CCC[C@@]3(C)O[C@]3([H])[C@@]12[H] |t:10| |
| LogP |
2.424 (est) |
| CAS DataBase Reference |
20554-84-1 |