Bismuth 2-ethylhexanoate
- Product NameBismuth 2-ethylhexanoate
- CAS67874-71-9
- MFC8H16BiO2
- MW353.19
- EINECS267-499-7
- MOL File67874-71-9.mol
Chemical Properties
| Density | 1,28 g/cm3 |
| vapor pressure | 4Pa at 20℃ |
| Flash point | 72°C |
| form | Liquid |
| Specific Gravity | 1.28 |
| Water Solubility | Not miscible with water. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C8H16O2.Bi.3H/c1-3-5-6-7(4-2)8(9)10;;;;/h7H,3-6H2,1-2H3,(H,9,10);;;; |
| InChIKey | DPUMEUCFOQDKAX-UHFFFAOYSA-N |
| SMILES | C(CC)(C(=O)O)CCCC.[BiH3] |
| EPA Substance Registry System | Bismuth(III) 2-ethylhexanoate (67874-71-9) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1993 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
