| Melting point |
35-40 °C (lit.) |
| Boiling point |
130-133 °C/0.1 mmHg (lit.) |
| Density |
1.095 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.575(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form |
Liquid After Melting |
| pka |
8.98±0.10(Predicted) |
| color |
Clear colorless to yellow |
| Water Solubility |
Soluble in chloroform, ethyl acetate, and methanol. Insoluble in water |
| Sensitive |
Air Sensitive |
| BRN |
167888 |
| InChI |
InChI=1S/C11H16N2O/c1-14-11-5-3-2-4-10(11)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
| InChIKey |
VNZLQLYBRIOLFZ-UHFFFAOYSA-N |
| SMILES |
N1(C2=CC=CC=C2OC)CCNCC1 |
| LogP |
1.67 |
| CAS DataBase Reference |
35386-24-4(CAS DataBase Reference) |
