Diphenyl isophthalate
- Product NameDiphenyl isophthalate
- CAS744-45-6
- MFC20H14O4
- MW318.32
- EINECS212-014-6
- MOL File744-45-6.mol
Chemical Properties
| Melting point | 136-138 °C (lit.) |
| Boiling point | 275 °C (10 mmHg) |
| Density | 1,2 g/cm3 |
| refractive index | 1.5400 (estimate) |
| Flash point | 223 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| InChI | 1S/C20H14O4/c21-19(23-17-10-3-1-4-11-17)15-8-7-9-16(14-15)20(22)24-18-12-5-2-6-13-18/h1-14H |
| InChIKey | FHESUNXRPBHDQM-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c2cccc(c2)C(=O)Oc3ccccc3 |
| CAS DataBase Reference | 744-45-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenyl isophthalate(744-45-6) |
| EPA Substance Registry System | Diphenyl isophthalate (744-45-6) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
