Terbutryn
- Product NameTerbutryn
- CAS886-50-0
- MFC10H19N5S
- MW241.36
- EINECS212-950-5
- MOL File886-50-0.mol
Chemical Properties
| Melting point | 104-105°C |
| Boiling point | 154-160°C |
| Density | 1.45 |
| refractive index | 1.5500 (estimate) |
| Flash point | 2 °C |
| storage temp. | APPROX 4°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.03±0.10(Predicted) |
| form | Powder |
| color | White |
| Water Solubility | 0.0025 g/100 mL |
| BRN | 611817 |
| Henry's Law Constant | 4.7×102 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | agriculture environmental |
| InChI | 1S/C10H19N5S/c1-6-11-7-12-8(15-10(2,3)4)14-9(13-7)16-5/h6H2,1-5H3,(H2,11,12,13,14,15) |
| InChIKey | IROINLKCQGIITA-UHFFFAOYSA-N |
| SMILES | CCNc1nc(NC(C)(C)C)nc(SC)n1 |
Safety Information
| Hazard Codes | Xi,N,Xn,F |
| Risk Statements | 36-50/53-20/21/22-11 |
| Safety Statements | 26-60-61-36/37-16 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | XY4725000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 886-50-0(Hazardous Substances Data) |
| Toxicity | LC50 (96-hour) for rainbow trout 3 mg/L, bluegill sunsh 4 mg/L, carp 4 mg/L and perch 4 mg/L (Hartley and Kidd, 1987); acute oral LD50 for rats 2,500 mg/kg (Hartley and Kidd, 1987), 2,045 mg/kg (RTECS, 1985). |
