Chemical Properties
| Melting point | 156-157℃ |
| Boiling point | 348.65°C (rough estimate) |
| Density | 1.1924 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO:43.5(Max Conc. mg/mL);151.95(Max Conc. mM) DMF:30.0(Max Conc. mg/mL);104.79(Max Conc. mM) Ethanol:30.0(Max Conc. mg/mL);104.79(Max Conc. mM) PBS (pH 7.2):10.0(Max Conc. mg/mL);34.93(Max Conc. mM) |
| form | A crystalline solid |
| Colour Index | 75280 |
| pka | 9.870±0.40(predicted) |
| color | Yellow to brown |
| optical activity | [α]/D 108.0 to 133.0°, c =0.5 in methanol |
| InChI | InChI=1S/C16H14O5/c17-9-1-2-10-14(4-9)21-7-16(20)6-8-3-12(18)13(19)5-11(8)15(10)16/h1-5,15,17-20H,6-7H2 |
| InChIKey | UWHUTZOCTZJUKC-UHFFFAOYSA-N |
| SMILES | C12C3C=CC(O)=CC=3OCC1(O)CC1=CC(O)=C(O)C=C21 |
| EPA Substance Registry System | Brazilin (474-07-7) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

