Chemical Properties
Melting point | 141.0 to 145.0 °C |
Boiling point | 334.5±42.0 °C(Predicted) |
Density | 1.06±0.1 g/cm3(Predicted) |
storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
solubility | DMSO:55.67(Max Conc. mg/mL);235.54(Max Conc. mM) DMF:20.0(Max Conc. mg/mL);84.62(Max Conc. mM) Ethanol:28.5(Max Conc. mg/mL);120.58(Max Conc. mM) |
pka | 13.02±0.60(Predicted) |
form | Solid |
color | White to Light yellow |
InChI | InChI=1S/C15H24O2/c1-9(2)13-8-14-11(4)5-6-12(14)10(3)7-15(13,16)17-14/h9,11-13,16H,3,5-8H2,1-2,4H3/t11-,12-,13-,14-,15+/m0/s1 |
InChIKey | QRMPRVXWPCLVNI-YYFQZIEXSA-N |
SMILES | C1[C@]2([H])[C@@]3(O[C@](O)(CC2=C)[C@H](C(C)C)C3)[C@@H](C)C1 |
LogP | 3.276 (est) |
CAS DataBase Reference | 4871-97-0 |