Cyclopentylacetic acid
- Product NameCyclopentylacetic acid
- CAS1123-00-8
- MFC7H12O2
- MW128.17
- EINECS214-368-7
- MOL File1123-00-8.mol
Chemical Properties
| Melting point | 14 °C |
| Boiling point | 231 °C |
| Density | 1.02 |
| refractive index | n 20/D 1.453 (lit.) |
| Flash point | 109 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Methanol |
| pka | 4.85±0.10(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| BRN | 2040821 |
| InChI | InChI=1S/C7H12O2/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H,8,9) |
| InChIKey | YVHAIVPPUIZFBA-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)CCCC1 |
| CAS DataBase Reference | 1123-00-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29162090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
