2-Amino-4-bromophenol
- Product Name2-Amino-4-bromophenol
- CAS40925-68-6
- MFC6H6BrNO
- MW188.02
- EINECS627-173-0
- MOL File40925-68-6.mol
Chemical Properties
| Melting point | 135-140°C |
| Boiling point | 282.8±25.0 °C(Predicted) |
| Density | 1.768±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 9.19±0.18(Predicted) |
| color | White to Gray to Brown |
| BRN | 3236448 |
| InChI | InChI=1S/C6H6BrNO/c7-4-1-2-6(9)5(8)3-4/h1-3,9H,8H2 |
| InChIKey | JHRIPENGTGSNPJ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C=C1N |
| CAS DataBase Reference | 40925-68-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-42/43-22 |
| Safety Statements | 26-36/37/39-36/37-22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
