3-Methylcyclohexylamine
- Product Name3-Methylcyclohexylamine
- CAS6850-35-7
- MFC7H15N
- MW113.2
- EINECS229-940-1
- MOL File6850-35-7.mol
Chemical Properties
| Melting point | -8.5°C (estimate) |
| Boiling point | 151°C(lit.) |
| Density | 0.8550 |
| refractive index | 1.4510 to 1.4550 |
| Flash point | 22 °C |
| storage temp. | 2-8°C, protect from light |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| pka | 10.61±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Henry's Law Constant | 1.1×100 mol/(m3Pa) at 25℃, Hilal et al. (2008) |
| InChI | InChI=1S/C7H15N/c1-6-3-2-4-7(8)5-6/h6-7H,2-5,8H2,1H3 |
| InChIKey | JYDYHSHPBDZRPU-UHFFFAOYSA-N |
| SMILES | C1(N)CCCC(C)C1 |
Safety Information
| Hazard Codes | F,C |
| Risk Statements | 10-22-34 |
| RIDADR | UN 2733 3/8/PG II |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| PackingGroup | II |
| HS Code | 2921309990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B |