Phosphoenolpyruvic acid cyclohexylammonium salt
- Product NamePhosphoenolpyruvic acid cyclohexylammonium salt
- CAS10526-80-4
- MFC6H13N.C3H5O6P
- MW267.22
- EINECS234-084-7
- MOL File10526-80-4.mol
Chemical Properties
| Melting point | 140°C |
| Density | 1.36 g/cm3 |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Almost white |
| Stability | Hygroscopic |
| InChI | InChI=1S/C6H13N.C3H5O6P/c7-6-4-2-1-3-5-6;1-2(3(4)5)9-10(6,7)8/h6H,1-5,7H2;1H2,(H,4,5)(H2,6,7,8) |
| InChIKey | VHFCNZDHPABZJO-UHFFFAOYSA-N |
| SMILES | O(P(O)(=O)O)C(=C)C(=O)O.C1CCCCC1N |
| CAS DataBase Reference | 10526-80-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propenoic acid, 2-(phosphonooxy)-, compd. with cyclohexanamine (1:1) (10526-80-4) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29213000 |
| Storage Class | 11 - Combustible Solids |
