2-Carbomethoxybenzenesulfonamide
- Product Name2-Carbomethoxybenzenesulfonamide
- CAS57683-71-3
- MFC8H9NO4S
- MW215.23
- EINECS260-903-2
- MOL File57683-71-3.mol
Chemical Properties
| Melting point | 126-128 °C (lit.) |
| Boiling point | 401.4±47.0 °C(Predicted) |
| Density | 1.377±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 9.65±0.60(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8H9NO4S/c1-13-8(10)6-4-2-3-5-7(6)14(9,11)12/h2-5H,1H3,(H2,9,11,12) |
| InChIKey | VSOOBQALJVLTBH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1S(N)(=O)=O |
| CAS DataBase Reference | 57683-71-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 2-(aminosulfonyl)benzoate(57683-71-3) |
| EPA Substance Registry System | Benzoic acid, 2-(aminosulfonyl)-, methyl ester (57683-71-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DH6830000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
