3,5-Bis(trifluoromethyl)benzyl bromide
- Product Name3,5-Bis(trifluoromethyl)benzyl bromide
- CAS32247-96-4
- MFC9H5BrF6
- MW307.03
- EINECS250-971-1
- MOL File32247-96-4.mol
Chemical Properties
| Melting point | 18°C |
| Boiling point | 136-140°C 14mm |
| Density | 1.675 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 79 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Difficult to mix. |
| form | Liquid |
| color | Clear colorless to yellow-brown |
| Specific Gravity | 1.675 |
| Sensitive | Lachrymatory |
| BRN | 656506 |
| InChI | InChI=1S/C9H5BrF6/c10-4-5-1-6(8(11,12)13)3-7(2-5)9(14,15)16/h1-3H,4H2 |
| InChIKey | ATLQGZVLWOURFU-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 32247-96-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzyl bromide(32247-96-4) |
Safety Information
| Hazard Codes | C,F |
| Risk Statements | 10-34 |
| Safety Statements | 26-36/37/39-45-25-16 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
