3,5-Bis(trifluoromethyl)benzyl alcohol
- Product Name3,5-Bis(trifluoromethyl)benzyl alcohol
- CAS32707-89-4
- MFC9H6F6O
- MW244.13
- EINECS251-168-9
- MOL File32707-89-4.mol
Chemical Properties
| Melting point | 53-56 °C(lit.) |
| Boiling point | 40°C 0,5mm |
| Density | 1.3954 (estimate) |
| Flash point | 208 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.92±0.10(Predicted) |
| form | powder to crystaline |
| color | White to Almost white |
| BRN | 2055358 |
| InChI | InChI=1S/C9H6F6O/c10-8(11,12)6-1-5(4-16)2-7(3-6)9(13,14)15/h1-3,16H,4H2 |
| InChIKey | BJTWPJOGDWRYDD-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 32707-89-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzyl alcohol(32707-89-4) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29052900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
