Gossypol-acetic acid
- Product NameGossypol-acetic acid
- CAS12542-36-8
- MFC32H34O10
- MW578.61
- EINECS623-939-3
- MOL File12542-36-8.mol
Chemical Properties
| Melting point | 164-168°C |
| storage temp. | −20°C |
| solubility | Soluble in acetone or methanol at 5mg/ml |
| form | Solid |
| color | Yellow to Very Dark Yellow |
| Major Application | food and beverages |
| InChIKey | NIOHNDKHQHVLKA-UHFFFAOYSA-N |
| SMILES | C12C(C(C)C)=C(C(O)=C(C=O)C=1C(O)=C(C1C(C)=CC3C(C(C)C)=C(O)C(O)=C(C=O)C=3C=1O)C(C)=C2)O.C(=O)(O)C |
| LogP | 6.157 (est) |
| CAS DataBase Reference | 12542-36-8(CAS DataBase Reference) |
| EPA Substance Registry System | Gossypol acetic acid (12542-36-8) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| RTECS | MD7360000 |
| HS Code | 29153900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 |