Gossypol-acetic acid
- Product NameGossypol-acetic acid
- CAS12542-36-8
- CBNumberCB8453967
- MFC32H34O10
- MW578.61
- EINECS623-939-3
- MDL NumberMFCD00058385
- MOL File12542-36-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 164-168°C |
| storage temp. | −20°C |
| solubility | Soluble in acetone or methanol at 5mg/ml |
| form | Solid |
| color | Yellow to Very Dark Yellow |
| Major Application | food and beverages |
| InChIKey | NIOHNDKHQHVLKA-UHFFFAOYSA-N |
| SMILES | C12C(C(C)C)=C(C(O)=C(C=O)C=1C(O)=C(C1C(C)=CC3C(C(C)C)=C(O)C(O)=C(C=O)C=3C=1O)C(C)=C2)O.C(=O)(O)C |
| LogP | 6.157 (est) |
| CAS DataBase Reference | 12542-36-8(CAS DataBase Reference) |
| NCI Dictionary of Cancer Terms | gossypol acetic acid |
| FDA UNII | S7RL72610R |
| EPA Substance Registry System | Gossypol acetic acid (12542-36-8) |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H351 | |||||||||
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-40 | |||||||||
| Safety Statements | 22-36 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | MD7360000 | |||||||||
| HS Code | 29153900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 | |||||||||
| NFPA 704: |
|
