Phenyltris(dimethylsiloxy)silane
- Product NamePhenyltris(dimethylsiloxy)silane
- CAS18027-45-7
- MFC12H26O3Si4
- MW330.67
- EINECS241-940-3
- MOL File18027-45-7.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 91 °C2 mm Hg(lit.) |
| Density | 0.942 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 188 °F |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| Specific Gravity | 0.942 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| BRN | 3380327 |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | InChI=1S/C12H26O3Si4/c1-16(2)13-19(14-17(3)4,15-18(5)6)12-10-8-7-9-11-12/h7-11,16-18H,1-6H3 |
| InChIKey | CQZDNELEZXTFEH-UHFFFAOYSA-N |
| SMILES | [SiH](C)(C)O[Si](O[SiH](C)C)(C1=CC=CC=C1)O[SiH](C)C |
| CAS DataBase Reference | 18027-45-7(CAS DataBase Reference) |
| EPA Substance Registry System | Trisiloxane, 3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl- (18027-45-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
