Tetrabutylammonium 4-toluenesulfonate
- Product NameTetrabutylammonium 4-toluenesulfonate
- CAS7182-86-7
- MFC23H43NO3S
- MW413.66
- EINECS230-548-8
- MOL File7182-86-7.mol
Chemical Properties
| Melting point | 70-72 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | powder to crystal |
| color | White to Light yellow |
| λmax | 220nm(H2O)(lit.) |
| BRN | 3643278 |
| InChI | 1S/C16H36N.C7H8O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-6-2-4-7(5-3-6)11(8,9)10/h5-16H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | REAVCZWUMGIGSW-UHFFFAOYSA-M |
| SMILES | Cc1ccc(cc1)S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
