Sodium bis(trimethylsilyl)amide
- Product NameSodium bis(trimethylsilyl)amide
- CAS1070-89-9
- MFC6H18NNaSi2
- MW183.37
- EINECS213-983-8
- MOL File1070-89-9.mol
Chemical Properties
| Melting point | 171-175 °C (lit.) |
| Boiling point | 67°C |
| Density | 0.904 g/mL at 25 °C |
| Flash point | 43 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in hexane, toluene, ether,terahydrofuran, benzene and toluene. |
| form | Liquid |
| Specific Gravity | 0.9 |
| color | Clear orange to brown |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 3629917 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | 1S/C6H18NSi2.Na/c1-8(2,3)7-9(4,5)6;/h1-6H3;/q-1;+1 |
| InChIKey | WRIKHQLVHPKCJU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N([Na])[Si](C)(C)C |
| CAS DataBase Reference | 1070-89-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,F |
| Risk Statements | 14-34-19-11-67-65-63-48/20-14/15-40-37 |
| Safety Statements | 26-45-62-36/37/39-33-16-43-8 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 4.3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
