| Melting point |
67-69 °C (lit.) |
| Boiling point |
72 °C/10 mmHg (lit.) |
| Density |
0.863 |
| refractive index |
1.4550 |
| Flash point |
67°C |
| storage temp. |
2-8°C, sealed storage, away from moisture and light |
| pka |
pK1:4.70(+1) (25°C) |
| form |
solid |
| Specific Gravity |
0.8635 |
| color |
white to colorless waxy |
| Sensitive |
Moisture Sensitive |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| BRN |
1851880 |
| InChI |
InChI=1S/C9H27NSi3/c1-11(2,3)10(12(4,5)6)13(7,8)9/h1-9H3 |
| InChIKey |
PEGHITPVRNZWSI-UHFFFAOYSA-N |
| SMILES |
[Si](C)(C)(C)N([Si](C)(C)C)[Si](C)(C)C |
| CAS DataBase Reference |
1586-73-8(CAS DataBase Reference) |
| EPA Substance Registry System |
Silanamine, 1,1,1-trimethyl-N,N-bis(trimethylsilyl)- (1586-73-8) |
