| Melting point |
28-32 °C (lit.) |
| Boiling point |
250 °C (lit.) |
| Density |
0.939 g/mL at 25 °C (lit.) |
| refractive index |
1.5087 (estimate) |
| Flash point |
>230 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| Water Solubility |
Insoluble in water |
| form |
powder to lump to clear liquid |
| pka |
11.68±0.18(Predicted) |
| color |
White or Colorless to Light yellow |
| InChI |
InChI=1S/C12H18O/c1-5-9-6-7-11(13)10(8-9)12(2,3)4/h6-8,13H,5H2,1-4H3 |
| InChIKey |
LZHCVNIARUXHAL-UHFFFAOYSA-N |
| SMILES |
C1(O)=CC=C(CC)C=C1C(C)(C)C |
| CAS DataBase Reference |
96-70-8(CAS DataBase Reference) |
| EPA Substance Registry System |
Phenol, 2-(1,1-dimethylethyl)-4-ethyl- (96-70-8) |
