| Melting point |
94 °C |
| Boiling point |
681.42°C (rough estimate) |
| Density |
1.2199 (rough estimate) |
| refractive index |
-10 ° (C=1, MeOH) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
DMSO (Slightly), Methanol (Slightly, Heated) |
| form |
powder to crystal |
| pka |
7.87±0.43(Predicted) |
| color |
White to Almost white |
| Water Solubility |
140μg/L at 20℃ |
| Stability |
Acid Sensitive |
| InChIKey |
LPICNYATEWGYHI-RLHFKRISNA-N |
| SMILES |
O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3=C(C(=NC=N3)NC(=O)C3=CC=CC=C3)N=C2)C[C@@H]1O |&1:25,27,47,r| |
| LogP |
5.94 at 20℃ |
| CAS DataBase Reference |
64325-78-6(CAS DataBase Reference) |
| EPA Substance Registry System |
Adenosine, N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy- (64325-78-6) |
