5-Bromo-2-methylbenzoic acid
- Product Name5-Bromo-2-methylbenzoic acid
- CAS79669-49-1
- MFC8H7BrO2
- MW215.04
- EINECS628-605-0
- MOL File79669-49-1.mol
Chemical Properties
| Melting point | 167-171°C |
| Boiling point | 319.4±30.0 °C(Predicted) |
| Density | 1.599±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.48±0.25(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H7BrO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | SEENCYZQHCUTSB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC=C1C |
| CAS DataBase Reference | 79669-49-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29163990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
