3-Methyldiphenylamine
- Product Name3-Methyldiphenylamine
- CAS1205-64-7
- MFC13H13N
- MW183.25
- EINECS214-885-8
- MOL File1205-64-7.mol
Chemical Properties
| Melting point | 30 °C |
| Boiling point | 315 °C/724 mmHg (lit.) |
| Density | 1.066 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 0.97±0.30(Predicted) |
| color | Colorless to Yellow to Orange |
| InChI | InChI=1S/C13H13N/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h2-10,14H,1H3 |
| InChIKey | TWPMMLHBHPYSMT-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=CC(C)=C1 |
| CAS DataBase Reference | 1205-64-7(CAS DataBase Reference) |
| EPA Substance Registry System | N-Phenyl-3-methylaniline (1205-64-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29214990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
