Tris(dimethylaminomethyl)phenol
- Product NameTris(dimethylaminomethyl)phenol
- CAS90-72-2
- MFC15H27N3O
- MW265.39
- EINECS202-013-9
- MOL File90-72-2.mol
Chemical Properties
| Melting point | 316℃ |
| Boiling point | 130-135 °C/1 mmHg (lit.) |
| Density | 0.969 g/mL at 25 °C (lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | <0.01 mm Hg ( 21 °C) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in water |
| form | clear liquid |
| pka | 6.27±0.50(Predicted) |
| color | White to Yellow to Green |
| Odor | Amine odor |
| Water Solubility | 850g/L at 20℃ |
| BRN | 795751 |
| InChI | 1S/C15H27N3O/c1-16(2)9-12-7-13(10-17(3)4)15(19)14(8-12)11-18(5)6/h7-8,19H,9-11H2,1-6H3 |
| InChIKey | AHDSRXYHVZECER-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cc(CN(C)C)c(O)c(CN(C)C)c1 |
Safety Information
| Hazard Codes | Xn,Xi,C |
| Risk Statements | 22-36/38-52/53-34 |
| Safety Statements | 26-28-2-61-45-36/37/39 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 1 |
| RTECS | SN3500000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29222900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 90-72-2(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 1200mg/kg |
