| Melting point |
98-100°C |
| Boiling point |
412.7±34.0 °C(Predicted) |
| Density |
1.168±0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Slightly soluble in water, freely soluble in dilute acetic acid and in methanol, slightly soluble in ethanol (96 per cent). |
| pka |
14.21±0.20(Predicted) |
| form |
Solid |
| color |
White to Almost white |
| InChI |
InChI=1S/C13H20N2O2/c16-11-13(17)10-14-6-8-15(9-7-14)12-4-2-1-3-5-12/h1-5,13,16-17H,6-11H2/t13-/m0/s1 |
| InChIKey |
PTVWPYVOOKLBCG-ZDUSSCGKSA-N |
| SMILES |
C(O)[C@@H](O)CN1CCN(C2=CC=CC=C2)CC1 |
| CAS DataBase Reference |
99291-25-5(CAS DataBase Reference) |
