L-Leucine benzyl ester p-toluenesulfonate salt
- Product NameL-Leucine benzyl ester p-toluenesulfonate salt
- CAS1738-77-8
- MFC20H27NO5S
- MW393.5
- EINECS217-095-1
- MOL File1738-77-8.mol
Chemical Properties
| Melting point | 153-160 °C |
| refractive index | 5 ° (C=2, DMF) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D +5.0±0.3°, c = 2% in DMF |
| BRN | 3566840 |
| InChI | InChI=1/C13H19NO2.C7H8O3S/c1-10(2)8-12(14)13(15)16-9-11-6-4-3-5-7-11;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,10,12H,8-9,14H2,1-2H3;2-5H,1H3,(H,8,9,10)/t12-;/s3 |
| InChIKey | QTQGHKVYLQBJLO-ZLBVLXFENA-N |
| SMILES | C1(S(=O)(=O)O)C=CC(C)=CC=1.C1(=CC=CC=C1)COC(=O)[C@@H](N)CC(C)C |&1:21,r| |
| CAS DataBase Reference | 1738-77-8(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
