BOC-L-3,4-Difluorophe
- Product NameBOC-L-3,4-Difluorophe
- CAS198474-90-7
- MFC14H17F2NO4
- MW301.29
- EINECS
- MOL File198474-90-7.mol
Chemical Properties
| Melting point | 95-105°C |
| Boiling point | 430.4±45.0 °C(Predicted) |
| Density | 1.270±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 3.79±0.10(Predicted) |
| color | White to Light yellow |
| optical activity | 5.3° (C=0.01 g/ml, MEOH) |
| BRN | 8566144 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H17F2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)7-8-4-5-9(15)10(16)6-8/h4-6,11H,7H2,1-3H3,(H,17,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | CYAOPVHXASZUDE-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(F)c(F)c1)C(O)=O |
| CAS DataBase Reference | 198474-90-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |