| Melting point |
~110 °C |
| Boiling point |
452.5±40.0 °C(Predicted) |
| alpha |
24 º (c=1,EtOH) |
| Density |
1.2167 (rough estimate) |
| refractive index |
1.6800 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka |
3.83±0.10(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| optical activity |
[α]20/D +26±3°, c = 1% in ethyl acetate |
| BRN |
4261946 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C14H18ClNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey |
BETBOAZCLSJOBQ-NSHDSACASA-N |
| SMILES |
C(O)(=O)[C@H](CC1=CC=C(Cl)C=C1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference |
68090-88-0(CAS DataBase Reference) |
