Trimethylolpropane Tris(3-mercaptopropionate)
- Product NameTrimethylolpropane Tris(3-mercaptopropionate)
- CAS33007-83-9
- MFC15H26O6S3
- MW398.56
- EINECS251-336-1
- MOL File33007-83-9.mol
Chemical Properties
| Boiling point | 220 °C0.3 mm Hg(lit.) |
| Density | 1.21 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Flash point | 205 °F |
| storage temp. | -70°C |
| pka | 9.14±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.2 (30℃)1.210 |
| Water Solubility | 320mg/L at 20℃ |
| InChI | InChI=1S/C15H26O6S3/c1-2-15(9-19-12(16)3-6-22,10-20-13(17)4-7-23)11-21-14(18)5-8-24/h22-24H,2-11H2,1H3 |
| InChIKey | IMQFZQVZKBIPCQ-UHFFFAOYSA-N |
| SMILES | C(OC(=O)CCS)C(CC)(COC(=O)CCS)COC(=O)CCS |
| LogP | 2.8 at 20℃ |
| EPA Substance Registry System | 3-Mercaptopropionic acid triester with trimethylolpropane (33007-83-9) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-61 |
| Safety Statements | 26-37/39-45-53 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |