| Melting point |
−30 °C (−22 °F; 243 K) |
| Boiling point |
280 °C (536 °F; 553 K) |
| Density |
1.18 |
| vapor density |
6.1 (vs air) |
| vapor pressure |
<1 mm Hg ( 20 °C) |
| refractive index |
n 20/D 1.440 (lit.) |
| Flash point |
146 °C |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
alcohol: soluble(lit.) |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Odor |
at 100.00 %. very mild alcoholic |
| PH |
5-6 (50g/l, H2O, 20℃) |
| Odor Type |
alcoholic |
| biological source |
synthetic |
| Water Solubility |
Soluble in water, alcohol, ether, benzene |
| Sensitive |
Hygroscopic |
| Merck |
14,2961 |
| BRN |
1706903 |
| Major Application |
flavors and fragrances |
| Cosmetics Ingredients Functions |
SOLVENT |
| InChI |
1S/2C7H12O5/c1-5(8)11-3-7(10)4-12-6(2)9;1-5(9)11-4-7(3-8)12-6(2)10/h7,10H,3-4H2,1-2H3;7-8H,3-4H2,1-2H3 |
| InChIKey |
TWSUHSVPDUPKDH-UHFFFAOYSA-N |
| SMILES |
CC(=O)OCC(O)COC(C)=O.CC(=O)OCC(CO)OC(C)=O |
| LogP |
-0.640 |
| CAS DataBase Reference |
25395-31-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,2,3-Propanetriol, diacetate(25395-31-7) |
| EPA Substance Registry System |
1,2,3-Propanetriol, diacetate (25395-31-7) |
