| Melting point |
105-153 °C(lit.) |
| Boiling point |
323.46°C (rough estimate) |
| Density |
1.0850 (rough estimate) |
| refractive index |
1.4940 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
almost transparency in Methanol |
| form |
powder to crystal |
| pka |
4.49±0.10(Predicted) |
| color |
White to Almost white |
| BRN |
2210618 |
| InChI |
InChI=1S/C13H18O3/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15/h6-9H,2-5,10H2,1H3,(H,14,15) |
| InChIKey |
HBQUXMZZODHFMJ-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)C1=CC=C(OCCCCCC)C=C1 |
| CAS DataBase Reference |
1142-39-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
4-(Hexyloxy)benzoic acid(1142-39-8) |
| EPA Substance Registry System |
Benzoic acid, 4-(hexyloxy)- (1142-39-8) |
